 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NC(C(CC)C)C(=O)NC(CC(C)C)C(=O)N |
| InChI: | InChI=1/C20H31N3O4/c1-5-14(4)17(19(25)22-16(18(21)24)11-13(2)3)23-20(26)27-12-15-9-7-6-8-10-15/h6-10,13-14,16-17H,5,11-12H2,1-4H3,(H2,21,24)(H,22,25)(H,23,26)/t14-,16+,17+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.1166 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 377.485 g/mol | logS: -4.86435 | SlogP: 2.6101 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.124514 | Sterimol/B1: 2.16899 | Sterimol/B2: 2.86021 | Sterimol/B3: 7.41376 | |||
| Sterimol/B4: 8.0345 | Sterimol/L: 17.7347 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 695.518 | Positive charged surface: 456.79 | Negative charged surface: 238.728 | Volume: 380.625 | |||
| Hydrophobic surface: 465.123 | Hydrophilic surface: 230.395 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.