 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)C(NC(=O)C(NC(OCc1ccccc1)=O)Cc1nc[nH]c1)Cc1c cccc1 |
| InChI: | InChI=1/C30H30N4O5/c35-28(26(17-25-18-31-21-32-25)34-30(37)39-20-24-14-8-3-9-15-24)33-27(16-22-10-4-1-5-11-22)29(36)38-19-23-12-6-2-7-13-23/h1-15,18,21,26-27H,16-17,19-20H2,(H,31,32)(H,33,35)(H,34,37)/t26-,27-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=114.328 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 526.593 g/mol | logS: -6.37235 | SlogP: 4.25084 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0526489 | Sterimol/B1: 2.4925 | Sterimol/B2: 3.1108 | Sterimol/B3: 5.41391 | |||
| Sterimol/B4: 10.4981 | Sterimol/L: 23.2682 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 879.29 | Positive charged surface: 551.675 | Negative charged surface: 327.615 | Volume: 502.75 | |||
| Hydrophobic surface: 735.335 | Hydrophilic surface: 143.955 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
