Type: Neutral
Formula: C14H19N3O5
SMILES: |
OC(=O)C(NC(=O)C(NC(=O)CN)Cc1ccccc1)CO |
InChI: |
InChI=1/C14H19N3O5/c15-7-12(19)16-10(6-9-4-2-1-3-5-9)13(20)17-11(8-18)14(21)22/h1-5,10-11,18H,6-8,15H2,(H,16,19)(H,17,20)(H,21,22)/t10-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 309.322 g/mol | logS: -1.24971 | SlogP: -1.76573 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0991192 | Sterimol/B1: 3.22816 | Sterimol/B2: 3.28871 | Sterimol/B3: 4.00421 |
Sterimol/B4: 8.85691 | Sterimol/L: 14.7168 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 549.163 | Positive charged surface: 365.602 | Negative charged surface: 183.561 | Volume: 285.375 |
Hydrophobic surface: 292.182 | Hydrophilic surface: 256.981 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |