 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)C(C(=O)[O-])c1ccccc1 |
| InChI: | InChI=1/C17H18N2O6S/c1-17(2)11(16(24)25)19-13(21)10(14(19)26-17)18-12(20)9(15(22)23)8-6-4-3-5-7-8/h3-7,9-11,14H,1-2H3,(H,18,20)(H,22,23)(H,24,25)/p-2/t9-,10-,11+,14-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=80.2036 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 376.389 g/mol | logS: -3.87091 | SlogP: -2.1829 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0798912 | Sterimol/B1: 3.15704 | Sterimol/B2: 3.97933 | Sterimol/B3: 4.45077 | |||
| Sterimol/B4: 5.29595 | Sterimol/L: 16.178 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 578.583 | Positive charged surface: 241.924 | Negative charged surface: 306.745 | Volume: 324 | |||
| Hydrophobic surface: 308.002 | Hydrophilic surface: 270.581 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
