 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C=C(C)C(=O)NC2=O)CC1NN=N)(=O)([O-])[O-] |
| InChI: | InChI=1/C10H16N5O7P/c1-5-3-15(10(17)12-9(5)16)8-2-6(13-14-11)7(22-8)4-21-23(18,19)20/h3,6-8H,2,4H2,1H3,(H2,11,13)(H,12,16,17)(H2,18,19,20)/p-2/t6-,7-,8+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-29.7771 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 347.224 g/mol | logS: -0.26877 | SlogP: -2.76373 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0684394 | Sterimol/B1: 2.99834 | Sterimol/B2: 3.19506 | Sterimol/B3: 5.30216 | |||
| Sterimol/B4: 6.77119 | Sterimol/L: 13.4825 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 526.742 | Positive charged surface: 252.138 | Negative charged surface: 274.604 | Volume: 268 | |||
| Hydrophobic surface: 205.78 | Hydrophilic surface: 320.962 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
