Type: Neutral
Formula: C10H14N2O5S
SMILES: |
S=C1NC(=O)C(=CN1C1OC(CO)C(O)C1O)C |
InChI: |
InChI=1/C10H14N2O5S/c1-4-2-12(10(18)11-8(4)16)9-7(15)6(14)5(3-13)17-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,18)/t5-,6-,7+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.297 g/mol | logS: -1.3605 | SlogP: -1.9541 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.139541 | Sterimol/B1: 2.61346 | Sterimol/B2: 3.60078 | Sterimol/B3: 3.71595 |
Sterimol/B4: 7.95252 | Sterimol/L: 11.325 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 448.464 | Positive charged surface: 269.43 | Negative charged surface: 179.034 | Volume: 225.75 |
Hydrophobic surface: 165.032 | Hydrophilic surface: 283.432 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |