Type: Neutral
Formula: C21H31NO4
SMILES: |
O(C)c1cc(ccc1OC)CCNC(=O)C12CC(O)C(CC1)(C)C2(C)C |
InChI: |
InChI=1/C21H31NO4/c1-19(2)20(3)9-10-21(19,13-17(20)23)18(24)22-11-8-14-6-7-15(25-4)16(12-14)26-5/h6-7,12,17,23H,8-11,13H2,1-5H3,(H,22,24)/t17-,20+,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 361.482 g/mol | logS: -3.53504 | SlogP: 2.93977 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0632471 | Sterimol/B1: 2.30549 | Sterimol/B2: 2.44151 | Sterimol/B3: 5.2697 |
Sterimol/B4: 7.19017 | Sterimol/L: 19.1499 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 642.943 | Positive charged surface: 494.66 | Negative charged surface: 148.283 | Volume: 367.375 |
Hydrophobic surface: 516.796 | Hydrophilic surface: 126.147 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |