Type: Neutral
Formula: C11H22N3O6P
SMILES: |
[PH](O)(=O)C(NC(=O)CCCCC(NC(=O)CN)C(O)=O)C |
InChI: |
InChI=1/C11H22N3O6P/c1-7(21(19)20)13-9(15)5-3-2-4-8(11(17)18)14-10(16)6-12/h7-8,21H,2-6,12H2,1H3,(H,13,15)(H,14,16)(H,17,18)(H,19,20)/t7-,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.286 g/mol | logS: -0.35048 | SlogP: -2.0661 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0524343 | Sterimol/B1: 2.20665 | Sterimol/B2: 5.14827 | Sterimol/B3: 5.23405 |
Sterimol/B4: 5.27248 | Sterimol/L: 17.0568 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 599.276 | Positive charged surface: 391.178 | Negative charged surface: 208.098 | Volume: 286.75 |
Hydrophobic surface: 257.448 | Hydrophilic surface: 341.828 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |