 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(C(=O)NC(CCC(=O)[O-])C(=O)[O-])C)C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C16H17N3O7/c1-8(13(22)17-11(15(24)25)6-7-12(20)21)19-14(23)9-4-2-3-5-10(9)18-16(19)26/h2-5,8,11H,6-7H2,1H3,(H,17,22)(H,18,26)(H,20,21)(H,24,25)/p-2/t8-,11+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=47.4098 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 361.31 g/mol | logS: -2.92796 | SlogP: -2.1724 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0969466 | Sterimol/B1: 2.25691 | Sterimol/B2: 4.40444 | Sterimol/B3: 5.71819 | |||
| Sterimol/B4: 5.79192 | Sterimol/L: 16.5655 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 581.448 | Positive charged surface: 283.688 | Negative charged surface: 297.76 | Volume: 309.75 | |||
| Hydrophobic surface: 274.839 | Hydrophilic surface: 306.609 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
