 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N(C(C(=O)NC(CCC(O)=O)C(O)=O)C)C(=O)Nc2c1cccc2 |
| InChI: | InChI=1/C16H17N3O7/c1-8(13(22)17-11(15(24)25)6-7-12(20)21)19-14(23)9-4-2-3-5-10(9)18-16(19)26/h2-5,8,11H,6-7H2,1H3,(H,17,22)(H,18,26)(H,20,21)(H,24,25)/t8-,11+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=39.4659 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 363.326 g/mol | logS: -2.40706 | SlogP: 0.497 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0793097 | Sterimol/B1: 2.43806 | Sterimol/B2: 2.62987 | Sterimol/B3: 5.19497 | |||
| Sterimol/B4: 7.40424 | Sterimol/L: 17.2982 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 583.906 | Positive charged surface: 335.114 | Negative charged surface: 248.793 | Volume: 308.625 | |||
| Hydrophobic surface: 277.059 | Hydrophilic surface: 306.847 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
