Type: Neutral
Formula: C18H28N4O4
SMILES: |
O(CCN(C(=O)CCC(=O)Nc1nccc(c1)C)CC(=O)NC(C)C)C |
InChI: |
InChI=1/C18H28N4O4/c1-13(2)20-17(24)12-22(9-10-26-4)18(25)6-5-16(23)21-15-11-14(3)7-8-19-15/h7-8,11,13H,5-6,9-10,12H2,1-4H3,(H,20,24)(H,19,21,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.446 g/mol | logS: -1.91406 | SlogP: 1.10832 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0468189 | Sterimol/B1: 2.9582 | Sterimol/B2: 3.69113 | Sterimol/B3: 4.20841 |
Sterimol/B4: 8.69085 | Sterimol/L: 20.1584 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 700.066 | Positive charged surface: 536.53 | Negative charged surface: 163.536 | Volume: 364.25 |
Hydrophobic surface: 533.716 | Hydrophilic surface: 166.35 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |