Type: Neutral
Formula: C17H27N2O5P
SMILES: |
P(OCC)(=O)(NC(Cc1ccccc1)C(OCC)=O)C(=O)NC(C)C |
InChI: |
InChI=1/C17H27N2O5P/c1-5-23-16(20)15(12-14-10-8-7-9-11-14)19-25(22,24-6-2)17(21)18-13(3)4/h7-11,13,15H,5-6,12H2,1-4H3,(H,18,21)(H,19,22)/t15-,25-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 370.386 g/mol | logS: -2.82902 | SlogP: 2.02777 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.125995 | Sterimol/B1: 2.4796 | Sterimol/B2: 3.5228 | Sterimol/B3: 4.13895 |
Sterimol/B4: 10.7359 | Sterimol/L: 15.812 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 664.997 | Positive charged surface: 439.84 | Negative charged surface: 225.157 | Volume: 358.375 |
Hydrophobic surface: 501.117 | Hydrophilic surface: 163.88 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |