Type: Neutral
Formula: C14H22N2O5
SMILES: |
O1C2CC(=O)CC(C(NC(=O)C(NC(=O)C)C)C1C)C2O |
InChI: |
InChI=1/C14H22N2O5/c1-6(15-8(3)17)14(20)16-12-7(2)21-11-5-9(18)4-10(12)13(11)19/h6-7,10-13,19H,4-5H2,1-3H3,(H,15,17)(H,16,20)/t6-,7-,10+,11+,12+,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 298.339 g/mol | logS: -1.00676 | SlogP: -0.8769 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.109321 | Sterimol/B1: 2.50075 | Sterimol/B2: 3.30488 | Sterimol/B3: 5.55574 |
Sterimol/B4: 5.6442 | Sterimol/L: 15.177 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 503.895 | Positive charged surface: 332.488 | Negative charged surface: 171.407 | Volume: 273.25 |
Hydrophobic surface: 305.06 | Hydrophilic surface: 198.835 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |