Type: Neutral
Formula: C13H23N3O4S3
SMILES: |
S1CC2NC(=O)NC2C1CCCCC(=O)NCCSS(=O)(=O)C |
InChI: |
InChI=1/C13H23N3O4S3/c1-23(19,20)22-7-6-14-11(17)5-3-2-4-10-12-9(8-21-10)15-13(18)16-12/h9-10,12H,2-8H2,1H3,(H,14,17)(H2,15,16,18)/t9-,10+,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 381.542 g/mol | logS: -2.76866 | SlogP: 0.5212 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.035093 | Sterimol/B1: 2.54336 | Sterimol/B2: 3.89912 | Sterimol/B3: 4.62663 |
Sterimol/B4: 5.15867 | Sterimol/L: 19.6645 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 631.071 | Positive charged surface: 393.667 | Negative charged surface: 237.404 | Volume: 327.375 |
Hydrophobic surface: 327.853 | Hydrophilic surface: 303.218 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |