Type: Neutral
Formula: C14H24N4O2S
SMILES: |
s1ccnc1NC(=O)CN(CCCC)C(=O)NC(C)(C)C |
InChI: |
InChI=1/C14H24N4O2S/c1-5-6-8-18(13(20)17-14(2,3)4)10-11(19)16-12-15-7-9-21-12/h7,9H,5-6,8,10H2,1-4H3,(H,17,20)(H,15,16,19) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 312.438 g/mol | logS: -2.99197 | SlogP: 2.6918 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.105349 | Sterimol/B1: 2.22371 | Sterimol/B2: 3.49363 | Sterimol/B3: 3.6698 |
Sterimol/B4: 10.1308 | Sterimol/L: 15.2392 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.648 | Positive charged surface: 405.962 | Negative charged surface: 183.686 | Volume: 306.25 |
Hydrophobic surface: 426.954 | Hydrophilic surface: 162.694 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |