 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1C(NC(=O)C)C=C(CC1O)C(=O)NC(CC#N)C(=O)N |
| InChI: | InChI=1/C13H18N4O5/c1-6(18)16-9-4-7(5-10(19)11(9)20)13(22)17-8(2-3-14)12(15)21/h4,8-11,19-20H,2,5H2,1H3,(H2,15,21)(H,16,18)(H,17,22)/t8-,9-,10-,11+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=49.7926 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 310.31 g/mol | logS: -0.62198 | SlogP: -2.57322 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.144595 | Sterimol/B1: 2.56115 | Sterimol/B2: 4.48318 | Sterimol/B3: 4.74173 | |||
| Sterimol/B4: 7.35765 | Sterimol/L: 14.7673 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 547.171 | Positive charged surface: 343.949 | Negative charged surface: 203.222 | Volume: 274.375 | |||
| Hydrophobic surface: 203.839 | Hydrophilic surface: 343.332 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.