Type: Neutral
Formula: C9H12N2O4S2
SMILES: |
SC1C(S)C(OC1CO)N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C9H12N2O4S2/c12-3-4-6(16)7(17)8(15-4)11-2-1-5(13)10-9(11)14/h1-2,4,6-8,12,16-17H,3H2,(H,10,13,14)/t4-,6+,7+,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 276.337 g/mol | logS: -2.25365 | SlogP: -0.6341 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0802939 | Sterimol/B1: 2.7636 | Sterimol/B2: 2.89811 | Sterimol/B3: 3.59035 |
Sterimol/B4: 7.11643 | Sterimol/L: 12.1946 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 428.05 | Positive charged surface: 238.635 | Negative charged surface: 189.416 | Volume: 218.75 |
Hydrophobic surface: 179.187 | Hydrophilic surface: 248.863 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |