Type: Neutral
Formula: C17H22N4O3
SMILES: |
OCC(NC(=O)c1cc2[nH]cnc2cc1)C(=O)N1CCCCCC1 |
InChI: |
InChI=1/C17H22N4O3/c22-10-15(17(24)21-7-3-1-2-4-8-21)20-16(23)12-5-6-13-14(9-12)19-11-18-13/h5-6,9,11,15,22H,1-4,7-8,10H2,(H,18,19)(H,20,23)/t15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.388 g/mol | logS: -2.77067 | SlogP: 1.0562 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0527811 | Sterimol/B1: 3.07089 | Sterimol/B2: 3.77458 | Sterimol/B3: 4.11659 |
Sterimol/B4: 5.15064 | Sterimol/L: 17.9263 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 566.154 | Positive charged surface: 406.178 | Negative charged surface: 159.976 | Volume: 311.375 |
Hydrophobic surface: 414.134 | Hydrophilic surface: 152.02 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |