Type: Ionized
Formula: C10H15O7-
SMILES: |
O1C2OC(OC2C(O)C1C(O)CC(=O)[O-])(C)C |
InChI: |
InChI=1/C10H16O7/c1-10(2)16-8-6(14)7(15-9(8)17-10)4(11)3-5(12)13/h4,6-9,11,14H,3H2,1-2H3,(H,12,13)/p-1/t4-,6-,7+,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 247.223 g/mol | logS: -0.64038 | SlogP: -2.2754 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.133646 | Sterimol/B1: 2.71577 | Sterimol/B2: 2.98591 | Sterimol/B3: 4.46699 |
Sterimol/B4: 4.72717 | Sterimol/L: 13.5785 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 423.169 | Positive charged surface: 258.04 | Negative charged surface: 165.129 | Volume: 205 |
Hydrophobic surface: 202.85 | Hydrophilic surface: 220.319 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|