 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1C(NC(=O)C([NH3+])C(C)C)C=C(CC1O)C(=O)NC(C(=O)N)C |
| InChI: | InChI=1/C15H26N4O5/c1-6(2)11(16)15(24)19-9-4-8(5-10(20)12(9)21)14(23)18-7(3)13(17)22/h4,6-7,9-12,20-21H,5,16H2,1-3H3,(H2,17,22)(H,18,23)(H,19,24)/p+1/t7-,9+,10-,11+,12+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=46.0133 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 343.404 g/mol | logS: -1.08026 | SlogP: -3.2204 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0536724 | Sterimol/B1: 2.63537 | Sterimol/B2: 3.94855 | Sterimol/B3: 4.48695 | |||
| Sterimol/B4: 6.2787 | Sterimol/L: 18.0359 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 610.012 | Positive charged surface: 421.352 | Negative charged surface: 188.66 | Volume: 327.25 | |||
| Hydrophobic surface: 251.627 | Hydrophilic surface: 358.385 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
