Type: Neutral
Formula: C17H20N2O3
SMILES: |
o1cccc1C(N1CC(CCC1)C(O)=O)c1ccncc1C |
InChI: |
InChI=1/C17H20N2O3/c1-12-10-18-7-6-14(12)16(15-5-3-9-22-15)19-8-2-4-13(11-19)17(20)21/h3,5-7,9-10,13,16H,2,4,8,11H2,1H3,(H,20,21)/t13-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 300.358 g/mol | logS: -1.98283 | SlogP: 2.96452 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.198668 | Sterimol/B1: 2.0718 | Sterimol/B2: 3.91553 | Sterimol/B3: 6.02513 |
Sterimol/B4: 6.45851 | Sterimol/L: 12.5986 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 522.702 | Positive charged surface: 352.698 | Negative charged surface: 170.003 | Volume: 291.875 |
Hydrophobic surface: 409.792 | Hydrophilic surface: 112.91 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |