 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CN(C(C(=O)NCCC(C)C)c1ccc(OCC)cc1)C(=O)c1cc(OC)c(OC)cc 1 |
| InChI: | InChI=1/C29H40N2O6/c1-6-36-23-12-9-21(10-13-23)27(28(32)30-16-15-20(2)3)31(19-24-8-7-17-37-24)29(33)22-11-14-25(34-4)26(18-22)35-5/h9-14,18,20,24,27H,6-8,15-17,19H2,1-5H3,(H,30,32)/t24-,27-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=234.147 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 512.647 g/mol | logS: -6.09828 | SlogP: 4.7228 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.56734 | Sterimol/B1: 2.05192 | Sterimol/B2: 6.80576 | Sterimol/B3: 6.9276 | |||
| Sterimol/B4: 14.8033 | Sterimol/L: 15.8851 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 867.295 | Positive charged surface: 667.238 | Negative charged surface: 200.057 | Volume: 509.375 | |||
| Hydrophobic surface: 736.396 | Hydrophilic surface: 130.899 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.