 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C=C(CCC)C(=O)NC2=O)CC1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C12H19N2O8P/c1-2-3-7-5-14(12(17)13-11(7)16)10-4-8(15)9(22-10)6-21-23(18,19)20/h5,8-10,15H,2-4,6H2,1H3,(H,13,16,17)(H2,18,19,20)/p-2/t8-,9+,10-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-5.61182 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 348.248 g/mol | logS: -1.25397 | SlogP: -2.5268 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0907184 | Sterimol/B1: 2.82129 | Sterimol/B2: 3.79254 | Sterimol/B3: 4.44946 | |||
| Sterimol/B4: 6.19059 | Sterimol/L: 15.7784 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 567.821 | Positive charged surface: 309.605 | Negative charged surface: 258.216 | Volume: 282.25 | |||
| Hydrophobic surface: 246.031 | Hydrophilic surface: 321.79 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
