Type: Neutral
Formula: C9H13FN5O5P
SMILES: |
P(O)(O)(=O)COC(Cn1c2N=C(NC(=O)c2nc1)N)CF |
InChI: |
InChI=1/C9H13FN5O5P/c10-1-5(20-4-21(17,18)19)2-15-3-12-6-7(15)13-9(11)14-8(6)16/h3,5H,1-2,4H2,(H2,17,18,19)(H3,11,13,14,16)/t5-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 321.205 g/mol | logS: -0.60338 | SlogP: -1.7412 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.3028 | Sterimol/B1: 2.3142 | Sterimol/B2: 2.50323 | Sterimol/B3: 6.09832 |
Sterimol/B4: 7.17554 | Sterimol/L: 11.3331 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 475.801 | Positive charged surface: 305.759 | Negative charged surface: 170.042 | Volume: 244.75 |
Hydrophobic surface: 155.05 | Hydrophilic surface: 320.751 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |