Type: Neutral
Formula: C12H19NO8
SMILES: |
O1C(C(O)C(O)CO)C(NC(=O)C)C(O)C=C1C(OC)=O |
InChI: |
InChI=1/C12H19NO8/c1-5(15)13-9-6(16)3-8(12(19)20-2)21-11(9)10(18)7(17)4-14/h3,6-7,9-11,14,16-18H,4H2,1-2H3,(H,13,15)/t6-,7+,9+,10+,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 305.283 g/mol | logS: -0.10955 | SlogP: -2.9782 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.34843 | Sterimol/B1: 2.07411 | Sterimol/B2: 2.56507 | Sterimol/B3: 7.09839 |
Sterimol/B4: 9.60515 | Sterimol/L: 12.0128 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 525.141 | Positive charged surface: 383.025 | Negative charged surface: 142.116 | Volume: 264.625 |
Hydrophobic surface: 278.69 | Hydrophilic surface: 246.451 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |