Type: Neutral
Formula: C11H12F2N2O4S
SMILES: |
S1C(CO)C(O)CC1N1C=C(C=C(F)F)C(=O)NC1=O |
InChI: |
InChI=1/C11H12F2N2O4S/c12-8(13)1-5-3-15(11(19)14-10(5)18)9-2-6(17)7(4-16)20-9/h1,3,6-7,9,16-17H,2,4H2,(H,14,18,19)/t6-,7+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 306.289 g/mol | logS: -2.4095 | SlogP: 0.4962 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.123896 | Sterimol/B1: 2.92647 | Sterimol/B2: 3.81735 | Sterimol/B3: 3.90982 |
Sterimol/B4: 4.97952 | Sterimol/L: 14.0774 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 471.43 | Positive charged surface: 278.88 | Negative charged surface: 192.55 | Volume: 238.875 |
Hydrophobic surface: 234.51 | Hydrophilic surface: 236.92 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |