Type: Neutral
Formula: C9H15N2O7P
SMILES: |
P(O)(O)(=O)COC(CN1C=C(C)C(=O)NC1=O)CO |
InChI: |
InChI=1/C9H15N2O7P/c1-6-2-11(9(14)10-8(6)13)3-7(4-12)18-5-19(15,16)17/h2,7,12H,3-5H2,1H3,(H,10,13,14)(H2,15,16,17)/t7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.2 g/mol | logS: 0.69991 | SlogP: -2.1155 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.274669 | Sterimol/B1: 2.37636 | Sterimol/B2: 4.70098 | Sterimol/B3: 5.33572 |
Sterimol/B4: 5.94085 | Sterimol/L: 11.0797 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 466.947 | Positive charged surface: 286.966 | Negative charged surface: 179.981 | Volume: 236.125 |
Hydrophobic surface: 184.561 | Hydrophilic surface: 282.386 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |