Type: Neutral
Formula: C10H15N3O4
SMILES: |
O=C1NC(=O)N(C=C1C)CCC(NC=O)CO |
InChI: |
InChI=1/C10H15N3O4/c1-7-4-13(10(17)12-9(7)16)3-2-8(5-14)11-6-15/h4,6,8,14H,2-3,5H2,1H3,(H,11,15)(H,12,16,17)/t8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 241.247 g/mol | logS: -0.39209 | SlogP: -1.061 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.132384 | Sterimol/B1: 2.21144 | Sterimol/B2: 3.84101 | Sterimol/B3: 3.98567 |
Sterimol/B4: 6.10063 | Sterimol/L: 13.0409 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 453.553 | Positive charged surface: 312.35 | Negative charged surface: 141.204 | Volume: 218.75 |
Hydrophobic surface: 222.545 | Hydrophilic surface: 231.008 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |