Type: Neutral
Formula: C10H13FN2O5
SMILES: |
FC1C(O)C(OC1CO)N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C10H13FN2O5/c1-4-2-13(10(17)12-8(4)16)9-7(15)6(11)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)/t5-,6+,7+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 260.221 g/mol | logS: -0.41483 | SlogP: -0.7219 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0948729 | Sterimol/B1: 2.7302 | Sterimol/B2: 3.23507 | Sterimol/B3: 3.5282 |
Sterimol/B4: 6.85791 | Sterimol/L: 11.3419 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 429.867 | Positive charged surface: 273.3 | Negative charged surface: 156.566 | Volume: 211.625 |
Hydrophobic surface: 184.363 | Hydrophilic surface: 245.504 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |