Type: Neutral
Formula: C18H18FN5O4
SMILES: |
Fc1ccc(cc1)-c1nnn(c1)C1CC(OC1CO)N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C18H18FN5O4/c1-10-7-23(18(27)20-17(10)26)16-6-14(15(9-25)28-16)24-8-13(21-22-24)11-2-4-12(19)5-3-11/h2-5,7-8,14-16,25H,6,9H2,1H3,(H,20,26,27)/t14-,15+,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 387.371 g/mol | logS: -2.83026 | SlogP: 1.2837 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0605723 | Sterimol/B1: 2.29201 | Sterimol/B2: 3.55585 | Sterimol/B3: 3.78741 |
Sterimol/B4: 8.84972 | Sterimol/L: 17.9372 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 619.876 | Positive charged surface: 344.258 | Negative charged surface: 275.617 | Volume: 333.375 |
Hydrophobic surface: 412.236 | Hydrophilic surface: 207.64 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |