Type: Neutral
Formula: C11H16N2O6S
SMILES: |
S(=O)(=O)(C)C1CC(OC1CO)N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H16N2O6S/c1-6-4-13(11(16)12-10(6)15)9-3-8(20(2,17)18)7(5-14)19-9/h4,7-9,14H,3,5H2,1-2H3,(H,12,15,16)/t7-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 304.323 g/mol | logS: -0.60662 | SlogP: -1.0375 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.142555 | Sterimol/B1: 2.6838 | Sterimol/B2: 4.4185 | Sterimol/B3: 4.9787 |
Sterimol/B4: 5.88305 | Sterimol/L: 13.6924 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 486.063 | Positive charged surface: 289.68 | Negative charged surface: 196.383 | Volume: 250.125 |
Hydrophobic surface: 266.132 | Hydrophilic surface: 219.931 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |