Type: Neutral
Formula: C10H15N2O6P
SMILES: |
[PH](OCC1OC(N2C=C(C)C(=O)NC2=O)CC1)(O)=O |
InChI: |
InChI=1/C10H15N2O6P/c1-6-4-12(10(14)11-9(6)13)8-3-2-7(18-8)5-17-19(15)16/h4,7-8,19H,2-3,5H2,1H3,(H,15,16)(H,11,13,14)/t7-,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 290.212 g/mol | logS: -1.18675 | SlogP: -0.7245 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.117298 | Sterimol/B1: 2.35269 | Sterimol/B2: 3.5896 | Sterimol/B3: 5.04574 |
Sterimol/B4: 5.57491 | Sterimol/L: 14.746 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 495.281 | Positive charged surface: 287.232 | Negative charged surface: 208.049 | Volume: 237.125 |
Hydrophobic surface: 274.956 | Hydrophilic surface: 220.325 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |