Type: Neutral
Formula: C10H12F2N2O4
SMILES: |
FC1(F)CC(OC1N1C=C(C)C(=O)NC1=O)CO |
InChI: |
InChI=1/C10H12F2N2O4/c1-5-3-14(9(17)13-7(5)16)8-10(11,12)2-6(4-15)18-8/h3,6,8,15H,2,4H2,1H3,(H,13,16,17)/t6-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 262.212 g/mol | logS: -1.19879 | SlogP: 0.6045 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.093236 | Sterimol/B1: 2.11001 | Sterimol/B2: 3.10011 | Sterimol/B3: 3.38218 |
Sterimol/B4: 7.05681 | Sterimol/L: 11.6193 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 425.854 | Positive charged surface: 247.059 | Negative charged surface: 178.795 | Volume: 208.625 |
Hydrophobic surface: 196.918 | Hydrophilic surface: 228.936 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |