Type: Neutral
Formula: C9H13N2O6P
SMILES: |
P(O)(O)(=O)C1OCC(N2C=C(C)C(=O)NC2=O)C1 |
InChI: |
InChI=1/C9H13N2O6P/c1-5-3-11(9(13)10-8(5)12)6-2-7(17-4-6)18(14,15)16/h3,6-7H,2,4H2,1H3,(H,10,12,13)(H2,14,15,16)/t6-,7+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 276.185 g/mol | logS: -0.02847 | SlogP: -1.3355 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.108749 | Sterimol/B1: 3.4432 | Sterimol/B2: 3.81656 | Sterimol/B3: 4.08202 |
Sterimol/B4: 4.28905 | Sterimol/L: 13.4028 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 437.86 | Positive charged surface: 279.654 | Negative charged surface: 158.206 | Volume: 216.75 |
Hydrophobic surface: 217.412 | Hydrophilic surface: 220.448 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |