Type: Neutral
Formula: C10H13N5O3S
SMILES: |
S1C(N2C=C(C)C(=O)NC2=O)C(N=[N+]=[N-])CC1CO |
InChI: |
InChI=1/C10H13N5O3S/c1-5-3-15(10(18)12-8(5)17)9-7(13-14-11)2-6(4-16)19-9/h3,6-7,9,16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,9+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 283.312 g/mol | logS: -1.51081 | SlogP: 0.9448 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.128189 | Sterimol/B1: 2.56055 | Sterimol/B2: 3.66202 | Sterimol/B3: 4.61301 |
Sterimol/B4: 5.5715 | Sterimol/L: 14.1131 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 473.24 | Positive charged surface: 263.62 | Negative charged surface: 209.62 | Volume: 235.5 |
Hydrophobic surface: 210.896 | Hydrophilic surface: 262.344 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |