Type: Neutral
Formula: C10H16N3O5P
SMILES: |
P(OCC1OC(N2C=CC(=NC2=O)N)CC1)(O)(=O)C |
InChI: |
InChI=1/C10H16N3O5P/c1-19(15,16)17-6-7-2-3-9(18-7)13-5-4-8(11)12-10(13)14/h4-5,7,9H,2-3,6H2,1H3,(H,15,16)(H2,11,12,14)/t7-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 289.228 g/mol | logS: -0.75923 | SlogP: -0.4404 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0880698 | Sterimol/B1: 2.19612 | Sterimol/B2: 2.94044 | Sterimol/B3: 4.27435 |
Sterimol/B4: 7.26265 | Sterimol/L: 15.1503 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 510.303 | Positive charged surface: 329.567 | Negative charged surface: 180.737 | Volume: 243.375 |
Hydrophobic surface: 268.348 | Hydrophilic surface: 241.955 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |