 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OCC(N2C=C(C)C(=O)NC2=O)CC1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C11H17N2O8P/c1-6-3-13(11(16)12-10(6)15)7-2-8(14)9(20-4-7)5-21-22(17,18)19/h3,7-9,14H,2,4-5H2,1H3,(H,12,15,16)(H2,17,18,19)/p-2/t7-,8+,9+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=4.53148 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 334.221 g/mol | logS: -0.3428 | SlogP: -3.2645 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.153834 | Sterimol/B1: 1.99688 | Sterimol/B2: 3.60828 | Sterimol/B3: 4.0112 | |||
| Sterimol/B4: 7.81395 | Sterimol/L: 12.8558 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 487.055 | Positive charged surface: 264.035 | Negative charged surface: 223.02 | Volume: 263.25 | |||
| Hydrophobic surface: 231.885 | Hydrophilic surface: 255.17 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
