Type: Neutral
Formula: C12H18N2O5S
SMILES: |
S1C(CO)C(O)CC1N1C=C(C(OC)C)C(=O)NC1=O |
InChI: |
InChI=1/C12H18N2O5S/c1-6(19-2)7-4-14(12(18)13-11(7)17)10-3-8(16)9(5-15)20-10/h4,6,8-10,15-16H,3,5H2,1-2H3,(H,13,17,18)/t6-,8+,9-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 302.351 g/mol | logS: -1.60464 | SlogP: -0.3582 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.086861 | Sterimol/B1: 2.52484 | Sterimol/B2: 2.62492 | Sterimol/B3: 4.56216 |
Sterimol/B4: 5.22001 | Sterimol/L: 15.0622 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 507.659 | Positive charged surface: 372.313 | Negative charged surface: 135.346 | Volume: 265.875 |
Hydrophobic surface: 280.584 | Hydrophilic surface: 227.075 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |