Type: Ionized
Formula: C9H10N5O3-
SMILES: |
OC(C(NC1=NC=NC2=NC=NC12)C(=O)[O-])C |
InChI: |
InChI=1/C9H11N5O3/c1-4(15)5(9(16)17)14-8-6-7(11-2-10-6)12-3-13-8/h2-6,15H,1H3,(H,16,17)(H,10,11,12,13,14)/p-1/t4-,5+,6+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 236.211 g/mol | logS: -1.77532 | SlogP: -2.6753 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.283803 | Sterimol/B1: 2.36031 | Sterimol/B2: 4.37237 | Sterimol/B3: 4.70223 |
Sterimol/B4: 6.4231 | Sterimol/L: 10.5281 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 411.267 | Positive charged surface: 251.996 | Negative charged surface: 159.271 | Volume: 200.25 |
Hydrophobic surface: 140.011 | Hydrophilic surface: 271.256 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|