Type: Ionized
Formula: C6H11N2O4S-
SMILES: |
S(=O)(=O)([O-])C1NC(C(=O)N)C(C1)C |
InChI: |
InChI=1/C6H12N2O4S/c1-3-2-4(13(10,11)12)8-5(3)6(7)9/h3-5,8H,2H2,1H3,(H2,7,9)(H,10,11,12)/p-1/t3-,4+,5-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 207.23 g/mol | logS: -0.36299 | SlogP: -1.659 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.175703 | Sterimol/B1: 2.33586 | Sterimol/B2: 3.02627 | Sterimol/B3: 3.34844 |
Sterimol/B4: 6.45733 | Sterimol/L: 10.5398 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 365.688 | Positive charged surface: 195.668 | Negative charged surface: 170.02 | Volume: 164.5 |
Hydrophobic surface: 121.074 | Hydrophilic surface: 244.614 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 3 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|