Type: Neutral
Formula: C9H17N5O3
SMILES: |
O=C1NC(NC2=NCC(NC12)C(O)C(O)C)N |
InChI: |
InChI=1/C9H17N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-6,9,12,15-16H,2,10H2,1H3,(H,11,13)(H,14,17)/t3-,4+,5+,6-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 243.267 g/mol | logS: 0.85495 | SlogP: -3.5713 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.117123 | Sterimol/B1: 3.02832 | Sterimol/B2: 3.46376 | Sterimol/B3: 4.03711 |
Sterimol/B4: 4.0392 | Sterimol/L: 13.8065 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 440.832 | Positive charged surface: 314.801 | Negative charged surface: 126.031 | Volume: 216.75 |
Hydrophobic surface: 149.967 | Hydrophilic surface: 290.865 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |