Type: Neutral
Formula: C10H14N2O5S
SMILES: |
S1C(CO)C(O)CC1N1C=C(OC)C(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O5S/c1-17-6-3-12(10(16)11-9(6)15)8-2-5(14)7(4-13)18-8/h3,5,7-8,13-14H,2,4H2,1H3,(H,11,15,16)/t5-,7+,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.297 g/mol | logS: -1.21161 | SlogP: -0.7892 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.114834 | Sterimol/B1: 2.18539 | Sterimol/B2: 3.21465 | Sterimol/B3: 4.46887 |
Sterimol/B4: 5.73152 | Sterimol/L: 13.7025 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 454.286 | Positive charged surface: 323.502 | Negative charged surface: 130.783 | Volume: 229 |
Hydrophobic surface: 228.299 | Hydrophilic surface: 225.987 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |