Type: Neutral
Formula: C11H15N5O4
SMILES: |
O1C(CO)C(O)C(OC)C1NC1=NC=NC2=NC=NC12 |
InChI: |
InChI=1/C11H15N5O4/c1-19-8-7(18)5(2-17)20-11(8)16-10-6-9(13-3-12-6)14-4-15-10/h3-8,11,17-18H,2H2,1H3,(H,12,13,14,15,16)/t5-,6-,7+,8-,11-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 281.272 g/mol | logS: -1.30413 | SlogP: -2.0815 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.169375 | Sterimol/B1: 2.40432 | Sterimol/B2: 3.73198 | Sterimol/B3: 4.90758 |
Sterimol/B4: 8.51046 | Sterimol/L: 12.6402 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 490.644 | Positive charged surface: 382.965 | Negative charged surface: 107.679 | Volume: 244.5 |
Hydrophobic surface: 228.366 | Hydrophilic surface: 262.278 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |