Type: Ionized
Formula: C7H12NO6P-2
SMILES: |
P(=O)([O-])(C([NH3+])CC(=O)[O-])CC(C(=O)[O-])C |
InChI: |
InChI=1/C7H14NO6P/c1-4(7(11)12)3-15(13,14)5(8)2-6(9)10/h4-5H,2-3,8H2,1H3,(H,9,10)(H,11,12)(H,13,14)/p-2/t4-,5+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 237.148 g/mol | logS: 0.89095 | SlogP: -5.3514 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.110923 | Sterimol/B1: 2.66485 | Sterimol/B2: 3.48901 | Sterimol/B3: 3.86822 |
Sterimol/B4: 4.62466 | Sterimol/L: 13.022 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 402.119 | Positive charged surface: 202.236 | Negative charged surface: 199.883 | Volume: 187 |
Hydrophobic surface: 122.194 | Hydrophilic surface: 279.925 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 0 | Acid groups: 6 | Basic groups: 1 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|