Type: Neutral
Formula: C17H26N4O5
SMILES: |
O=C1NC(=O)N(C=C1C)CC(=O)NC(C(=O)NCC1CCCCC1)CO |
InChI: |
InChI=1/C17H26N4O5/c1-11-8-21(17(26)20-15(11)24)9-14(23)19-13(10-22)16(25)18-7-12-5-3-2-4-6-12/h8,12-13,22H,2-7,9-10H2,1H3,(H,18,25)(H,19,23)(H,20,24,26)/t13-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 366.418 g/mol | logS: -2.64098 | SlogP: -0.3844 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0423353 | Sterimol/B1: 2.22553 | Sterimol/B2: 2.83733 | Sterimol/B3: 4.5883 |
Sterimol/B4: 7.19454 | Sterimol/L: 19.7489 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 648.642 | Positive charged surface: 464.269 | Negative charged surface: 184.373 | Volume: 342.625 |
Hydrophobic surface: 414.209 | Hydrophilic surface: 234.433 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |