 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C(=O)[O-])C)C(NC(=O)C([NH3+])CCCNC(=[NH2+])N)Cc1ccccc 1 |
| InChI: | InChI=1/C18H28N6O4/c1-11(17(27)28)23-16(26)14(10-12-6-3-2-4-7-12)24-15(25)13(19)8-5-9-22-18(20)21/h2-4,6-7,11,13-14H,5,8-10,19H2,1H3,(H,23,26)(H,24,25)(H,27,28)(H4,20,21,22)/p+1/t11-,13-,14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=3.74775 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 393.468 g/mol | logS: -2.71521 | SlogP: -4.97743 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0797994 | Sterimol/B1: 2.4747 | Sterimol/B2: 3.01838 | Sterimol/B3: 4.6357 | |||
| Sterimol/B4: 11.9376 | Sterimol/L: 18.1339 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 701.544 | Positive charged surface: 493.303 | Negative charged surface: 208.241 | Volume: 383.875 | |||
| Hydrophobic surface: 352.448 | Hydrophilic surface: 349.096 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 4 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
