Type: Neutral
Formula: C19H25N3O
SMILES: |
O=C(N)c1c(-c2cccnc2)c(n(CC=C)c1C)CCCCC |
InChI: |
InChI=1/C19H25N3O/c1-4-6-7-10-16-18(15-9-8-11-21-13-15)17(19(20)23)14(3)22(16)12-5-2/h5,8-9,11,13H,2,4,6-7,10,12H2,1,3H3,(H2,20,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 311.429 g/mol | logS: -4.01291 | SlogP: 4.14249 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.142416 | Sterimol/B1: 3.36511 | Sterimol/B2: 4.35047 | Sterimol/B3: 5.50104 |
Sterimol/B4: 8.03543 | Sterimol/L: 14.3272 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 600.826 | Positive charged surface: 419.557 | Negative charged surface: 181.269 | Volume: 331.75 |
Hydrophobic surface: 413.687 | Hydrophilic surface: 187.139 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |