 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC1=NC=NC2=NC=NC12)C(CC)C |
| InChI: | InChI=1/C11H15N5O2/c1-3-6(2)7(11(17)18)16-10-8-9(13-4-12-8)14-5-15-10/h4-8H,3H2,1-2H3,(H,17,18)(H,12,13,14,15,16)/t6-,7-,8-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=57.2272 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 249.274 g/mol | logS: -2.63617 | SlogP: 0.3247 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.124871 | Sterimol/B1: 2.22264 | Sterimol/B2: 3.77273 | Sterimol/B3: 4.64477 | |||
| Sterimol/B4: 5.35681 | Sterimol/L: 13.057 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 455.466 | Positive charged surface: 323.272 | Negative charged surface: 132.194 | Volume: 230.75 | |||
| Hydrophobic surface: 200.003 | Hydrophilic surface: 255.463 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
