Type: Neutral
Formula: C17H16ClF2N3O2
SMILES: |
Clc1ccc(nc1)NC(=O)NC1CC1c1c(F)c(OCC)ccc1F |
InChI: |
InChI=1/C17H16ClF2N3O2/c1-2-25-13-5-4-11(19)15(16(13)20)10-7-12(10)22-17(24)23-14-6-3-9(18)8-21-14/h3-6,8,10,12H,2,7H2,1H3,(H2,21,22,23,24)/t10-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 367.783 g/mol | logS: -4.23769 | SlogP: 4.0895 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0658382 | Sterimol/B1: 2.30804 | Sterimol/B2: 2.57475 | Sterimol/B3: 4.00326 |
Sterimol/B4: 10.666 | Sterimol/L: 16.4538 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 604.767 | Positive charged surface: 352.851 | Negative charged surface: 251.916 | Volume: 319.875 |
Hydrophobic surface: 496.387 | Hydrophilic surface: 108.38 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |