Type: Neutral
Formula: C24H40N2O5
SMILES: |
O(C(=O)CCC=C)CC(NC(=O)C(CC=C)CC(=O)NC(CO)C)CC1CCCCC1 |
InChI: |
InChI=1/C24H40N2O5/c1-4-6-13-23(29)31-17-21(14-19-11-8-7-9-12-19)26-24(30)20(10-5-2)15-22(28)25-18(3)16-27/h4-5,18-21,27H,1-2,6-17H2,3H3,(H,25,28)(H,26,30)/t18-,20-,21-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 436.593 g/mol | logS: -5.00198 | SlogP: 3.0304 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.125224 | Sterimol/B1: 2.4412 | Sterimol/B2: 5.65892 | Sterimol/B3: 7.1452 |
Sterimol/B4: 9.10808 | Sterimol/L: 19.6882 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 833.307 | Positive charged surface: 601.099 | Negative charged surface: 232.208 | Volume: 455 |
Hydrophobic surface: 586.967 | Hydrophilic surface: 246.34 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |